Search Result

Results for "

Ph-Bis(C1-N-(C2-NH-Boc)2)

" in MedChemExpress (MCE) Product Catalog:

By Targets:	ADC Linker (6) Amino Acid Derivatives (1) Biochemical Assay Reagents (6) Drug-Linker Conjugates for ADC (1) Isotope-Labeled Compounds (1) PROTAC Linkers (52) Reference Standards (1)
By Research Areas:	Cancer (56)
Click Chemistry:	PROTAC Synthesis (12) Azide (8) Alkynes (4)

Inhibitors & Agonists

Peptides

Isotope-Labeled Compounds

Click Chemistry

Cat. No.	상품명	Target	연구분야	Chemical Structure

HY-W017829

*1,7-Bis-Boc-1,4,7-triazaheptane*	PROTAC Linkers	Cancer
1,7-Bis-Boc-1,4,7-triazaheptane is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140538

*N-Boc-N-bis(PEG2-acid)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG2-acid) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140257

*NH-bis(PEG3-Boc)*	PROTAC Linkers	Cancer
NH-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-23641

*NH-bis(C1-Boc)*	ADC Linker	Cancer
NH-bis(C1-Boc)is a uncleavable linker used for antibody-drug conjugates (ADC).

HY-140252

*NH-bis(C1-PEG1-Boc)*	PROTAC Linkers	Cancer
NH-bis(C1-PEG1-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140254

*N-(Amino-PEG3)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Amino-PEG3)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-130531

*NH-bis(C2-PEG2-NH-Boc)*	PROTAC Linkers	Cancer
NH-bis(C2-PEG2-NH-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140540

*N-Boc-N-bis(PEG4-acid)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG4-acid) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-42222

*N1,N5-Bis-boc-spermidine*	Biochemical Assay Reagents	Others
N1,N5-Bis-Boc-spermidine is a linker containing an amino group with two Boc-protected amino groups. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine.

HY-140575

*N-Mal-N-bis(PEG4-NH-Boc)*	PROTAC Linkers	Cancer
N-Mal-N-bis(PEG4-NH-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140258

*NH-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
NH-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140256

*NH-bis(PEG2-C2-Boc)*	PROTAC Linkers	Cancer
NH-bis(PEG2-C2-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-108379

Boc-C2-Urea-bis(Boc)-C4-Urea-4-phenylacetic acid	ADC Linker	Cancer
Boc-C2-Urea-bis(Boc)-C4-Urea-4-phenylacetic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs) .

HY-140555

*N-Boc-N-bis(PEG3-azide)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140090

*N-(Boc-PEG1)-N-bis(PEG2-propargyl)*	PROTAC Linkers	Cancer
N-(Boc-PEG1)-N-bis(PEG2-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Boc-PEG1)-N-bis(PEG2-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140092

*N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl)*	PROTAC Linkers	Cancer
N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140554

*N-Boc-N-bis(C2-PEG1-azide)*	PROTAC Linkers	Cancer
N-Boc-N-bis(C2-PEG1-azide) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(C2-PEG1-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140872

*N-(Boc-PEG2)-N-bis(PEG3-azide)*	PROTAC Linkers	Cancer
N-(Boc-PEG2)-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Boc-PEG2)-N-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-143849

*N-bis(t-boc-N-amido-PEG3)-N-(PEG3-acid) hydrochloride*	PROTAC Linkers	Cancer
N-bis(t-boc-N-amido-PEG3)-N-(PEG3-acid) hydrochloride is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-W837047

bis (Boc-Azetidine)	PROTAC Linkers	Cancer
bis (Boc-Azetidine) is a PROTAC linker that can be used in the synthesis of PROTACs.

HY-138326

**Bis-PEG18-Boc**	PROTAC Linkers	Cancer
Bis-PEG18-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-138504

**Bis-PEG2-Boc**	PROTAC Linkers	Cancer
Bis-PEG2-Boc is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140600

*S-Bis-(PEG4-Boc)*	PROTAC Linkers	Cancer
S-Bis-(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140336

*C-NH-Boc-C-Bis-(C-PEG1-Boc)*	PROTAC Linkers	Cancer
C-NH-Boc-C-Bis-(C-PEG1-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-W007599S

*L-Lysine-bis-N-t-BOC-d4*	Isotope-Labeled Compounds	Others
L-Lysine-bis-N-t-BOC-d₄ is the deuterium labeled L-Lysine-bis-N-t-BOC.

HY-140535

Boc-NH-Bis(acid-PEG1-m)	Biochemical Assay Reagents	Others
Boc-NH-Bis(acid-PEG1-m) is a PEG derivative contains carboxylic acid moieties. Boc-NH-Bis(acid-PEG1-m) can be conjugated with amine containing molecule .

HY-130449

*N-Boc-N-bis(PEG4-OH)*	ADC Linker PROTAC Linkers	Cancer
N-Boc-N-bis(PEG4-OH) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N-Boc-N-bis(PEG4-OH) is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs) .

HY-117079

*N-Boc-N-bis(PEG2-OH)*	ADC Linker PROTAC Linkers	Cancer
N-Boc-N-bis(PEG2-OH) is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. N-Boc-N-bis(PEG2-OH) is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs) .

HY-W141820

*Fmoc-Phe(bis-Boc-4-guanidino)-OH*	Amino Acid Derivatives	Others
Fmoc-Phe(bis-Boc-4-guanidino)-OH is a phenylalanine derivative .

HY-140553

*N-Boc-N-bis-PEG5*	PROTAC Linkers	Cancer
N-Boc-N-bis-PEG5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140588

*Benzyl-N-bis(PEG3-Boc)* N-Benzyl-N-Bis(PEG3-t-butyl ester)	PROTAC Linkers	Cancer
Benzyl-N-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140539

*N-Boc-N-bis(PEG3-acid)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG3-acid) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-W092176

*1,9-Bis-boc-1,5,9-triazanonane*	Biochemical Assay Reagents	Others
1,9-Bis-Boc-1,5,9-triazanonane is a linker containing two Boc-protected amino groups. The Boc groups can be deprotected under mild acidic conditions to form the free amines.

HY-141250

*Hydroxy-Amino-bis(PEG1-C2-Boc)*	PROTAC Linkers	Cancer
Hydroxy-Amino-bis(PEG1-C2-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140089

*N-Boc-N-bis(PEG2-propargyl)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG2-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(PEG2-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-141251

*N-(Hydroxy-PEG3)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Hydroxy-PEG3)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140255

*N-(Amino-PEG4)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Amino-PEG4)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140446

*N-(Aminooxy-PEG3)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Aminooxy-PEG3)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140253

*N-(Amino-PEG3)-N-bis(PEG3-Boc)*	PROTAC Linkers	Cancer
N-(Amino-PEG3)-N-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-141288

*N-(Biotin-PEG4)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Biotin-PEG4)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140393

*N-(Tos-PEG4)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Tos-PEG4)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140576

*N-Mal-N-bis(PEG2-C2-Boc)*	PROTAC Linkers	Cancer
N-Mal-N-bis(PEG2-C2-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140157

*N-Me-N-bis(PEG4-C2-Boc)*	PROTAC Linkers	Cancer
N-Me-N-bis(PEG4-C2-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-42213

*N1,N4-Bis-Boc-spermidine*	Biochemical Assay Reagents	Others
N1,N4-Bis-Boc-spermidine is a linker containing an amino group with two Boc-protected amino groups. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine.

HY-140867

*N-(Azido-PEG2)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Azido-PEG2)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG2)-N-bis(PEG4-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140868

*N-(Azido-PEG3)-N-bis(PEG3-Boc)*	PROTAC Linkers	Cancer
N-(Azido-PEG3)-N-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG3)-N-bis(PEG3-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140869

*N-(Azido-PEG3)-N-bis(PEG4-Boc)*	PROTAC Linkers	Cancer
N-(Azido-PEG3)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG3)-N-bis(PEG4-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140557

*N-Boc-N-bis(PEG3-NHS ester)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG3-NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-140558

*N-Boc-N-bis(PEG4-NHS ester)*	PROTAC Linkers	Cancer
N-Boc-N-bis(PEG4-NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs .

HY-130941

Fmoc-N-bis-PEG3-NH-Boc	ADC Linker	Cancer
Fmoc-N-bis-PEG3-NH-Boc is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs) .

Cat. No.	상품명		Classification

HY-140555

*N-Boc-N-bis(PEG3-azide)*		PROTAC Synthesis Azide
N-Boc-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140090

*N-(Boc-PEG1)-N-bis(PEG2-propargyl)*		PROTAC Synthesis Alkynes
N-(Boc-PEG1)-N-bis(PEG2-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Boc-PEG1)-N-bis(PEG2-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140092

*N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl)*		Alkynes PROTAC Synthesis
N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140554

*N-Boc-N-bis(C2-PEG1-azide)*		Azide PROTAC Synthesis
N-Boc-N-bis(C2-PEG1-azide) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(C2-PEG1-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140872

*N-(Boc-PEG2)-N-bis(PEG3-azide)*		Azide PROTAC Synthesis
N-(Boc-PEG2)-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Boc-PEG2)-N-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140089

*N-Boc-N-bis(PEG2-propargyl)*		Alkynes PROTAC Synthesis
N-Boc-N-bis(PEG2-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(PEG2-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140867

*N-(Azido-PEG2)-N-bis(PEG4-Boc)*		Azide PROTAC Synthesis
N-(Azido-PEG2)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG2)-N-bis(PEG4-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140868

*N-(Azido-PEG3)-N-bis(PEG3-Boc)*		PROTAC Synthesis Azide
N-(Azido-PEG3)-N-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG3)-N-bis(PEG3-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140869

*N-(Azido-PEG3)-N-bis(PEG4-Boc)*		PROTAC Synthesis Azide
N-(Azido-PEG3)-N-bis(PEG4-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Azido-PEG3)-N-bis(PEG4-Boc) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140556

*N-Boc-N-bis(PEG4-azide)*		PROTAC Synthesis Azide
N-Boc-N-bis(PEG4-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-Boc-N-bis(PEG4-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

HY-140093

*N-(PEG2-Boc)-N-bis(PEG2-propargyl)*		Alkynes PROTAC Synthesis
N-(PEG2-Boc)-N-bis(PEG2-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(PEG2-Boc)-N-bis(PEG2-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

HY-140871

*N-(Boc-PEG3)-N-bis(PEG3-azide)*		PROTAC Synthesis Azide
N-(Boc-PEG3)-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs . N-(Boc-PEG3)-N-bis(PEG3-azide) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

온라인 문의

Your information is safe with us. * Required Fields.

MCE Japan Authorized Agent ナミキ商事株式会社コスモ・バイオ株式会社重松貿易株式会社
호칭			Country or Region *
고객명 *			회사명 *
Department *
메일주소 *			상품명 *
Cat. No.			Requested quantity *
전화번호 *
비고

온라인 문의

Inquiry Information

상품명:
Cat. No.:
수량:
MCE Japan Authorized Agent: