sulfo-Cy7.5 amine 

sulfo-Cy7.5 amine is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy7.5 is a near-infrared fluorescent dye commonly used for biolabeling and cell imaging. The amine functionality of sulfo-Cy7.5 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy7.5 amine can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples.

1181.59

C₅₁H₅₉K₃N₄O₁₃S₄

Solid

Brown to black

CN(/C(C1(C)C)=C/C=C2CCCC(/C=C/C3=[N+](CCCCCC(NCCCCCCN)=O)C(C=CC4=C5C=C(S(=O)(O[K])=O)C=C4S(=O)(O[K])=O)=C5C3(C)C)=C\2)C6=C1C(C=C(S([O-])(=O)=O)C=C7S(=O)(O[K])=O)=C7C=C6

Room temperature in continental US; may vary elsewhere.

-20°C, protect from light, stored under nitrogen

*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen)