223465-80-3
Chemical Structure
Arborcandin E
- CAS. Nr.: 223465-80-3
- Formula:C60H107N13O18
- Molecular Weight:1298.57
SMILES: NC(C(O)CC1C(N[C@](C(N[C@@](C(NC(C(NCC(NCCC(NC(C(N[C@@H](C(N[C@H](C(N[C@@H](C(N1)=O)C)=O)CC(N)=O)=O)CC(N)=O)=O)CCCCCCCC(O)CCCCCC)=O)=O)=O)CCC(O)CCCCCCCCCC)=O)([H])[C@H](O)C)=O)([H])[C@H](O)C)=O)=O
Biological Activity: Arborcandin E is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin E exhibits IC50 values of 0.1 μg/mL and 0.012 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin E has an MIC of 0.5-2 μg/mL against the genus Candida[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arborcandin E | Arborcandin E is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin E exhibits IC50 values of 0.1 μg/mL and 0.012 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin E has an MIC of 0.5-2 μg/mL against the genus Candida. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords