3087336-56-6
Chemical Structure
TrkB activator-1
- CAS. Nr.: 3087336-56-6
- Formula:C13H16D3N3O3
- Molecular Weight:268.33
IUPAC Name: (R)-1-(acetyl-d3)-N-((S)-2-methyl-1-(oxazol-2-yl)propyl)azetidine-2-carboxamide
InChIKey: ODIJUXSMCMABGX-BUTXRPMDSA-N
SMILES: O=C(N[C@H](C1=NC=CO1)C(C)C)[C@H]2CCN2C(C([2H])([2H])[2H])=O
Biological Activity: TrkB activator-1 is a specific, orally active and brain-penetrant tropomyosin receptor kinase B (TrkB) activator. TrkB activator-1 shows potent antidepressant effects through activation of the activates the BDNF (brainderived neurotrophic factor)-Tropomyosin-related kinase B (TrkB)-CREB (cAMP response element binding protein) signaling aixs. TrkB activator-1 increaes neuroplasticity. TrkB activator-1 can be used for the research of neurological disease, such as depression[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TrkB activator-1 | TrkB activator-1 is a specific, orally active and brain-penetrant tropomyosin receptor kinase B (TrkB) activator. TrkB activator-1 shows potent antidepressant effects through activation of the activates the BDNF (brainderived neurotrophic factor)-Tropomyosin-related kinase B (TrkB)-CREB (cAMP response element binding protein) signaling aixs. TrkB activator-1 increaes neuroplasticity. TrkB activator-1 can be used for the research of neurological disease, such as depression. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords