2914912-82-4
Chemical Structure
N-Acetyltryptamine α-D-Glucose-3-phosphate
- CAS. Nr.: 2914912-82-4
- Formula:C18H25N2O10P
- Molecular Weight:460.37
InChIKey: HQUHPUZXZZKHPM-HSFUPAIVSA-N
SMILES: CC(NCCC(C1=C2)=CNC1=CC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)OP(O)(O)=O)O)=O
Biological Activity: N-Acetyltryptamine α-D-Glucose-3-phosphate (Compound 30) a nucleotide analogue. N-Acetyltryptamine α-D-Glucose-3-phosphate can modify RNA and enhance its stability.by covalently connecting modular glucose nucleotides. N-Acetyltryptamine α-D-Glucose-3-phosphate can be used for the researches of cancer and infection[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Acetyltryptamine α-D-Glucose-3-phosphate | N-Acetyltryptamine α-D-Glucose-3-phosphate (Compound 30) a nucleotide analogue. N-Acetyltryptamine α-D-Glucose-3-phosphate can modify RNA and enhance its stability.by covalently connecting modular glucose nucleotides. N-Acetyltryptamine α-D-Glucose-3-phosphate can be used for the researches of cancer and infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||