1667-99-8
Chemical Structure
Mordant Blue 29
- No. CAS: 1667-99-8
- Formula:C23H15Cl2Na3O9S
- Molecular Weight:607.30
IUPAC Name: (Z)-5-((3-carboxy-4-hydroxy-5-methylcyclohexa-2,5-dien-1-ylidene)(2,6-dichloro-3-sulfophenyl)methyl)-2-hydroxy-3-methylbenzoic acid, trisodium salt
InChIKey: LIQDGONXFBYRPC-UMCYPVTFSA-N
SMILES: O=C(O[Na])C(C(C(C)=C/1)O)=CC1=C(C2=CC(C(O[Na])=O)=C(O)C(C)=C2)/C3=C(Cl)C=CC(S(=O)(O[Na])=O)=C3Cl
Biological Activity: Chromeazurol S is a compound belonging to the class of azo dyes. It is often used as an indicator in analytical chemistry to detect metal ions such as copper, nickel, and cobalt. Chromeazurol S turns from yellow to blue in the presence of metal ions, allowing them to be detected and quantified. It can be applied to a test strip or added directly to a solution for analysis.
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mordant Blue 29 | Chromeazurol S is a compound belonging to the class of azo dyes. It is often used as an indicator in analytical chemistry to detect metal ions such as copper, nickel, and cobalt. Chromeazurol S turns from yellow to blue in the presence of metal ions, allowing them to be detected and quantified. It can be applied to a test strip or added directly to a solution for analysis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords