887751-89-5
Chemical Structure
Dihydroaltenuene B
- CAS No.: 887751-89-5
- Formula:C15H18O6
- Molecular Weight:294.30
IUPAC Name: (2R,3R,4aR,10bS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-1,2,3,4,4a,10b-hexahydro-6H-benzo[c]chromen-6-one
InChIKey: HDWRQDAKGPKDFF-PETRGTFGSA-N
SMILES: C[C@@]12[C@](C[C@H]([C@@H](C2)O)O)([H])C3=CC(OC)=CC(O)=C3C(O1)=O
Biological Activity: Dihydroaltenuene B is a potent mushroom tyrosinase inhibitor with an IC50 of 38.33 µM. Dihydroaltenuene B shows the hydrogen bonding interactions between the 3-OH and 4’-OH and the His244, Met280 and Gly281 residues of tyrosinase[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dihydroaltenuene B | Dihydroaltenuene B is a potent mushroom tyrosinase inhibitor with an IC50 of 38.33 µM. Dihydroaltenuene B shows the hydrogen bonding interactions between the 3-OH and 4’-OH and the His244, Met280 and Gly281 residues of tyrosinase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords