2738877-91-1
Chemical Structure
Lp-PLA2-IN-4
- CAS No.: 2738877-91-1
- Formula:C23H18F5N3O4
- Molecular Weight:495.40
IUPAC Name: (5R)-10-((3,5-difluoro-4-(3-(trifluoromethyl)phenoxy)benzyl)oxy)-2,3,5,6-tetrahydro-8H-1,5-methanopyrimido[1,6-d][1,4,6]oxadiazocin-8-one
InChIKey: WQTLAEMFJNYZHB-MRXNPFEDSA-N
SMILES: O=C1N2C(N3C[C@@H](OCC3)C2)=CC(OCC4=CC(F)=C(C(F)=C4)OC5=CC(C(F)(F)F)=CC=C5)=N1
Biological Activity: Lp-PLA2-IN-4 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-4 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2021228159A1, compound 38)[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lp-PLA2-IN-4 | Lp-PLA2-IN-4 is a potent inhibitor of lipoprotein-associated phospholipase A2 (Lp-PLA2). Lp-PLA2 previously known as platelet- activating factor acetylhydrolase (PAF-AH), is a phospholipase A2 enzyme involved in hydrolysis of lipoprotein lipids or phospholipids. Lp-PLA2-IN-4 has the potential for the research of diseases associated with the activity of Lp-PLA2, for example atherosclerosis, Alzheimer's disease (extracted from patent WO2021228159A1, compound 38). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords