163597-25-9
Chemical Structure
Antcin B
- CAS No.: 163597-25-9
- Formula:C29H40O5
- Molecular Weight:468.62
InChIKey: DVORYMAGXQGBQK-QCMFUGJUSA-N
SMILES: C[C@@]12C3=C(C(C[C@@]1([H])[C@@H](C(CC2)=O)C)=O)[C@@]4([H])[C@](CC3=O)([C@@](CC4)([H])[C@H](C)CCC(C(C)C(O)=O)=C)C
Biological Activity: Antcin B is a SARS-CoV-2 3-chymotrypsin-like protease (3CL Pro) inhibitor. Antcin B binds to multiple key amino acid residues of 3CL Pro(such as Leu141, Asn142, Glu166, His163, etc.) through hydrogen bonds, salt bridges, and hydrophobic interactions, thereby inhibiting the activity of 3CL Pro, blocking the cleavage process of viral polyproteins, and suppressing the replication of the SARS-CoV-2 virus in host cells. Antcin B is promising for research of COVID-19[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antcin B | Antcin B is a SARS-CoV-2 3-chymotrypsin-like protease (3CL Pro) inhibitor. Antcin B binds to multiple key amino acid residues of 3CL Pro(such as Leu141, Asn142, Glu166, His163, etc.) through hydrogen bonds, salt bridges, and hydrophobic interactions, thereby inhibiting the activity of 3CL Pro, blocking the cleavage process of viral polyproteins, and suppressing the replication of the SARS-CoV-2 virus in host cells. Antcin B is promising for research of COVID-19. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords