4918-96-1
Chemical Structure
Pyrocatechol sulfate
- CAS No.: 4918-96-1
- Formula:C6H6O5S
- Molecular Weight:190.17
InChIKey: MZPWKJZDOCIALD-UHFFFAOYSA-N
SMILES: O=S(O)(OC1=C(O)C=CC=C1)=O
Biological Activity: Pyrocatechol sulfate is a phenolic metabolite present in human blood plasma, associated with the intake of certain foods such as berries and the status of the gut microbiota. Pyrocatechol sulfate can serve as a biomarker for uremia. Along with other phenolic sulfates, Pyrocatechol sulfate plays a role in regulating various biological functions, including those related to brain health and the rhythmic beating of cardiomyocytes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pyrocatechol sulfate | Pyrocatechol sulfate is a phenolic metabolite present in human blood plasma, associated with the intake of certain foods such as berries and the status of the gut microbiota. Pyrocatechol sulfate can serve as a biomarker for uremia. Along with other phenolic sulfates, Pyrocatechol sulfate plays a role in regulating various biological functions, including those related to brain health and the rhythmic beating of cardiomyocytes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Catechol sulfate-d4 sodium | 99.78% | Catechol sulfate-d4 (sodium) is the deuterium labeled Catechol sulfate sodium. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||