1818294-49-3
Chemical Structure
Azido-PEG8-TFP ester
- CAS No.: 1818294-49-3
- Formula:C25H37F4N3O10
- Molecular Weight:615.57
IUPAC Name: 2,3,5,6-tetrafluorophenyl 1-azido-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate
InChIKey: ICPUCGMOWKDMAI-UHFFFAOYSA-N
SMILES: O=C(OC1=C(F)C(F)=CC(F)=C1F)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG8-TFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG8-TFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG8-TFP ester | 95.0% | Azido-PEG8-TFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-TFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords