2342575-87-3
Chemical Structure
DOPE-PEG(2000) Carboxylic acid sodium
- CAS No.: 2342575-87-3
- Formula:N/A
- Molecular Weight:2000 (Average)
IUPAC Name: sodium (R)-2,3-bis(oleoyloxy)propyl (1-carboxy-10-oxo-2,4,8-trioxa-11-azatridecan-13-yl) phosphate
InChIKey: OCYYQJGXFWXCJU-JQRYTBKHSA-M
SMILES: [H][C@@](COP(OCCNC(COCCCOCOCC(O)=O)=O)(O[Na])=O)(OC(CCCCCCC/C=C\CCCCCCCC)=O)COC(CCCCCCC/C=C\CCCCCCCC)=O
Biological Activity: DOPE-PEG(2000) Carboxylic acid sodium is a stabilizer. DOPE-PEG(2000) Carboxylic acid sodium produce a coating around the ferrofluid droplet chains which are dispersed in 5CB. DOPE-PEG(2000) Carboxylic acid sodium tends to fold, effectively shielding the surrounding LC molecules from the homeotropic anchoring at the droplet interface and leading to smaller deformations and thus also creating a more stable interface[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DOPE-PEG(2000) Carboxylic acid sodium | DOPE-PEG(2000) Carboxylic acid sodium is a stabilizer. DOPE-PEG(2000) Carboxylic acid sodium produce a coating around the ferrofluid droplet chains which are dispersed in 5CB. DOPE-PEG(2000) Carboxylic acid sodium tends to fold, effectively shielding the surrounding LC molecules from the homeotropic anchoring at the droplet interface and leading to smaller deformations and thus also creating a more stable interface. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||