2409077-01-4
Chemical Structure
(-)-Mornaphthoate B
- CAS No.: 2409077-01-4
- Formula:C18H18O6
- Molecular Weight:330.33
InChIKey: UIZAGDRWBVSTHS-JZXOWHBKSA-N
SMILES: O=C(C1=C([C@]([H])(OC2)[C@@H](OC)[C@@]2(C)O3)C3=C4C=CC=CC4=C1O)OC
Biological Activity: (-)-Mornaphthoate B is a Methyl 2-naphthoate derivative. (-)-Mornaphthoate B can be isolated from the roots of Morinda officinalis var. officinalis. (-)-Mornaphthoate B exhibits no activity against Acetylcholinesterase and Butyrylcholinesterase. (-)-Mornaphthoate B can be used in the research of non-small cell lung cancer and triple-negative breast cancer[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Mornaphthoate B | (-)-Mornaphthoate B is a Methyl 2-naphthoate derivative. (-)-Mornaphthoate B can be isolated from the roots of Morinda officinalis var. officinalis. (-)-Mornaphthoate B exhibits no activity against Acetylcholinesterase and Butyrylcholinesterase. (-)-Mornaphthoate B can be used in the research of non-small cell lung cancer and triple-negative breast cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords