51-98-9
Chemical Structure
Norethindrone acetate
Synonym(s): 19-Norethindrone acetate
- CAS No.: 51-98-9
- Formula:C22H28O3
- Molecular Weight:340.46
IUPAC Name: (8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl acetate
InChIKey: IMONTRJLAWHYGT-ZCPXKWAGSA-N
SMILES: C#C[C@]1(OC(C)=O)CC[C@@]2([H])[C@]3([H])CCC4=CC(CC[C@]4([H])[C@@]3([H])CC[C@]12C)=O
Biological Activity: Norethindrone acetate is a female hormone used for the research of endometriosis[1]. Norethindrone acetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Norethindrone acetate | 99.79% | Norethindrone acetate is a female hormone used for the research of endometriosis. Norethindrone acetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Norethindrone acetate (Standard) | 99.47% | Norethindrone acetate (Standard) is the analytical standard of Norethindrone acetate. This product is intended for research and analytical applications. Norethindrone acetate is a female hormone used for the research of endometriosis. Norethindrone acetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||