136236-51-6
Chemical Structure
Rasagiline
Synonym(s): (R)-AGN1135; TVP1012
- CAS No.: 136236-51-6
- Formula:C12H13N
- Molecular Weight:171.24
IUPAC Name: (R)-N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine
InChIKey: RUOKEQAAGRXIBM-GFCCVEGCSA-N
SMILES: C#CCN[C@H]1C2=CC=CC=C2CC1
Biological Activity: Rasagiline (R-AGN1135) is a highly potent selective irreversible mitochondrial monoamine oxidase (MAO) inhibitor with IC50s of 4.43 nM and 412 nM for rat brain MAO B and A activity, respectively[1]. Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rasagiline | 99.88% | Rasagiline (R-AGN1135) is a highly potent selective irreversible mitochondrial monoamine oxidase (MAO) inhibitor with IC50s of 4.43 nM and 412 nM for rat brain MAO B and A activity, respectively. Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rasagiline (Standard) | ≥98% | Rasagiline (Standard) is the analytical standard of Rasagiline. This product is intended for research and analytical applications. Rasagiline (R-AGN1135) is a highly potent selective irreversible mitochondrial monoamine oxidase (MAO) inhibitor with IC50s of 4.43?nM and 412?nM for rat brain MAO B and A activity, respectively. Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
