38465-86-0
Chemical Structure
(1,5-Cyclooctadiene)bis(methyldiphenylphosphine)iridium(I) hexafluorophosphate
- CAS No.: 38465-86-0
- Formula:C34H38IrP2.PF6
- Molecular Weight:845.79
InChIKey: PVRRXJPRRVMZIY-OHHPTVSFSA-N
SMILES: C[Ir+](C)([P](C1=CC=CC=C1)(C)C2=CC=CC=C2)[P](C3=CC=CC=C3)(C)C4=CC=CC=C4.F[P-](F)(F)(F)(F)F.C5=C\CC/C=C\CC/5
Biological Activity: (1,5-Cyclooctadiene)bis(methyldiphenylphosphine)iridium(I) hexafluorophosphate is a highly efficient catalyst with excellent hydrogenation activity. It can catalyze the reaction of hydrogen and organic substrates in various chemical reactions. This compound is often used to synthesize important chemical intermediates and compounds.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(1,5-Cyclooctadiene)bis(methyldiphenylphosphine)iridium(I) hexafluorophosphate | 97.0% | (1,5-Cyclooctadiene)bis(methyldiphenylphosphine)iridium(I) hexafluorophosphate is a highly efficient catalyst with excellent hydrogenation activity. It can catalyze the reaction of hydrogen and organic substrates in various chemical reactions. This compound is often used to synthesize important chemical intermediates and compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||