173658-86-1
Chemical Structure
3-O-Caffeoyl-5-O-feruloylquinic acid
- CAS. Nr.: 173658-86-1
- Formula:C26H26O12
- Molecular Weight:530.48
InChIKey: HFPFOWZKUHZLHL-VOHNXBSUSA-N
SMILES: O[C@]1(C(O)=O)C[C@@H](OC(/C=C/C2=CC(OC)=C(O)C=C2)=O)[C@H](O)[C@H](OC(/C=C/C3=CC(O)=C(O)C=C3)=O)C1
Biological Activity: 3-O-Caffeoyl-5-O-feruloylquinic acid is a quinic acid-based phenolic compound that can be isolated from Eryngium bourgatii. 3-O-Caffeoyl-5-O-feruloylquinic acid regulates free radical scavenging and inflammatory pathways, exerting antioxidant activity through electron transfer and hydrogen atom transfer mechanisms. It also inhibits TNF-α-induced reactive oxygen species (ROS) production and the production of monocyte chemoattractant protein-1 (MCP-1) and its transcripts in human umbilical vein endothelial cells (HUVECs).
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-O-Caffeoyl-5-O-feruloylquinic acid | 3-O-Caffeoyl-5-O-feruloylquinic acid is a quinic acid-based phenolic compound that can be isolated from Eryngium bourgatii. 3-O-Caffeoyl-5-O-feruloylquinic acid regulates free radical scavenging and inflammatory pathways, exerting antioxidant activity through electron transfer and hydrogen atom transfer mechanisms. It also inhibits TNF-α-induced reactive oxygen species (ROS) production and the production of monocyte chemoattractant protein-1 (MCP-1) and its transcripts in human umbilical vein endothelial cells (HUVECs). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords