1818294-48-2
Chemical Structure
Azido-PEG5-PFP ester
- CAS. Nr.: 1818294-48-2
- Formula:C19H24F5N3O7
- Molecular Weight:501.40
IUPAC Name: perfluorophenyl 1-azido-3,6,9,12,15-pentaoxaoctadecan-18-oate
InChIKey: YSQIHRPBWCEUAX-UHFFFAOYSA-N
SMILES: O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)CCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG5-PFP ester is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. Azido-PEG5-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG5-PFP ester | 98.0% | Azido-PEG5-PFP ester is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG5-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords