2361069-97-6
Chemical Structure
RuPhos Pd G1 methyl t-butyl ether adduct (MTBE)
- CAS. Nr.: 2361069-97-6
- Formula:C43H65ClNO3PPd
- Molecular Weight:816.83
InChIKey: FINPLSBBDVRBPA-UHFFFAOYSA-M
SMILES: [Cl-][Pd+2]1([P](C2CCCCC2)(C3CCCCC3)C4=CC=CC=C4C5=C(OC(C)C)C=CC=C5OC(C)C)[C-]6=C(CC[NH2]1)C=CC=C6.COC(C)(C)C
Biological Activity: RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) is a highly efficient catalyst with excellent cross-coupling activity. RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) is widely used in organic synthesis and can be used to promote various reactions to build complex molecular structures. RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) has good adaptability to temperature and reaction conditions, which enables it to exhibit excellent catalytic performance in different reaction systems.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) | RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) is a highly efficient catalyst with excellent cross-coupling activity. RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) is widely used in organic synthesis and can be used to promote various reactions to build complex molecular structures. RuPhos Pd G1 methyl t-butyl ether adduct (MTBE) has good adaptability to temperature and reaction conditions, which enables it to exhibit excellent catalytic performance in different reaction systems. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
