5785-44-4
Chemical Structure
Calcium citrate tetrahydrate, 99%
Synonym(s): Tricalcium dicitrate tetrahydrate, 99%
- CAS. Nr.: 5785-44-4
- Formula:C6H8O7.3/2Ca.2H2O
- Molecular Weight:288.30
SMILES: [Ca].O=C(O)CC(O)(C(=O)O)CC(=O)O.O
Biological Activity: Calcium citrate tetrahydrate, 99% exhibits the ability to release more calcium ions in a short time therefore allowing a high activity, and a high concentration of calcium ions that can stimulate bone formation[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Calcium citrate tetrahydrate, 99% | 99.65% | Calcium citrate tetrahydrate, 99% exhibits the ability to release more calcium ions in a short time therefore allowing a high activity, and a high concentration of calcium ions that can stimulate bone formation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords