609-06-3
Chemical Structure
L-Xylose
Synonym(s): L-(-)-Xylose
- CAS. Nr.: 609-06-3
- Formula:C5H10O5
- Molecular Weight:150.13
IUPAC Name: (2S,3R,4S)-2,3,4,5-tetrahydroxypentanal
InChIKey: PYMYPHUHKUWMLA-WISUUJSJSA-N
SMILES: O=C[C@H]([C@@H]([C@H](CO)O)O)O
Biological Activity: L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Xylose | 97.0% | L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Xylose (Standard) | ≥98% | L-Xylose (Standard) (L-(-)-Xylose (Standard)) is the analytical standard of L-Xylose (HY-78139). This product is intended for research and analytical applications. L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Xylose-1-13C | 99.89% | L-Xylose-1-13C (L-(-)-Xylose-1-13C) is the 13C labeled L-Xylose (HY-78139). L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Xylose-5-13C | 99.9% | L-Xylose-5-13C (L-(-)-Xylose-5-13C) is the 13C labeled L-Xylose (HY-78139). L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Xylose-2-13C | 99.0% | L-Xylose-2-13C ((L-(-)-Xylose-2-13C)) is the 13C labeled L-Xylose (HY-78139). L-Xylose (L-(-)-Xylose) is a rare sugar and the levorotatory form of Xylose (HY-N0537). L-Xylose can be used as a raw material for the synthesis of various drugs and bioactive molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||