75290-60-7
Chemical Structure
14,15-Leukotriene C4
Synonym(s): Eoxin C4
- CAS. Nr.: 75290-60-7
- Formula:C30H47N3O9S
- Molecular Weight:625.77
IUPAC Name: (5Z,8Z,10E,12E,14R,15S)-14-(((R)-2-((S)-4-amino-4-carboxybutanamido)-3-((carboxymethyl)amino)-3-oxopropyl)thio)-15-hydroxyicosa-5,8,10,12-tetraenoic acid
InChIKey: OBQVBASHEWLKCQ-PKBWNXTMSA-N
SMILES: O=C(O)CNC([C@H](CS[C@@H]([C@@H](O)CCCCC)/C=C/C=C/C=C\C/C=C\CCCC(O)=O)NC(CC[C@@H](C(O)=O)N)=O)=O
Biological Activity: 14,15-Leukotriene C4 (Eoxin C4) is a Leukotriene compound produced by the enzymatic reaction of arachidonic acid. 14,15-Leukotriene C4 has the activity of promoting inflammatory response. 14,15-Leukotriene C4 can increase the permeability of blood vessels, causing fluid and white blood cells to leak out of the blood vessels, which increases the number of inflammatory cells in the tissue. 14,15-Leukotriene C4 can be used in studies of asthma and other inflammatory diseases[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
14,15-Leukotriene C4 | 98.9% | 14,15-Leukotriene C4 (Eoxin C4) is a Leukotriene compound produced by the enzymatic reaction of arachidonic acid. 14,15-Leukotriene C4 has the activity of promoting inflammatory response. 14,15-Leukotriene C4 can increase the permeability of blood vessels, causing fluid and white blood cells to leak out of the blood vessels, which increases the number of inflammatory cells in the tissue. 14,15-Leukotriene C4 can be used in studies of asthma and other inflammatory diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords