83286-58-2
Chemical Structure
Pencycuron-d5
- CAS. Nr.: 83286-58-2
- Formula:C19H16D5ClN2O
- Molecular Weight:333.87
IUPAC Name: 1-(4-chlorobenzyl)-1-cyclopentyl-3-(phenyl-d5)urea
InChIKey: OGYFATSSENRIKG-FSTBWYLISA-N
SMILES: ClC(C=C1)=CC=C1CN(C2CCCC2)C(NC3=C([2H])C([2H])=C([2H])C([2H])=C3[2H])=O
Biological Activity: Pencycuron-d5 is the deuterium labeled Pencycuron (HY-B2048). Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pencycuron-d5 | 99.9% | Pencycuron-d5 is the deuterium labeled Pencycuron (HY-B2048). Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pencycuron (Standard) | ≥98% | Pencycuron (Standard) is the analytical standard of Pencycuron. This product is intended for research and analytical applications. Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pencycuron | Pencycuron is a benzoylurea fungicide. Pencycuron kills fungi by inhibiting the synthesis of fungal cell walls.Pencycuron can be used in research on the control of fungal diseases on crops, such as sheath blight, powdery mildew and late blight. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||