146306-79-8
Chemical Structure
(2S,3R)-Fmoc-Abu(3-N3)-OH
- CAS No.: 146306-79-8
- Formula:C19H18N4O4
- Molecular Weight:366.37
IUPAC Name: (2S,3R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidobutanoic acid
InChIKey: LLJMYBCJYQGZOS-DIFFPNOSSA-N
SMILES: [N-]=[N+]=N[C@H](C)[C@@H](C(O)=O)NC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O
Biological Activity: (2S,3R)-Fmoc-Abu(3-N3)-OH is a click chemistry reagent containing an azide group. (2S,3R)-Fmoc-Abu(3-N3)-OH can be used for the research of various biochemical[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(2S,3R)-Fmoc-Abu(3-N3)-OH | (2S,3R)-Fmoc-Abu(3-N3)-OH is a click chemistry reagent containing an azide group. (2S,3R)-Fmoc-Abu(3-N3)-OH can be used for the research of various biochemical. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords