65914-17-2
Chemical Structure
(E/Z)-Polydatin
Synonym(s): (E/Z)-Piceid
- CAS No.: 65914-17-2
- Formula:C20H22O8
- Molecular Weight:390.38
IUPAC Name: (2S,3R,4S,5S,6R)-2-(3-hydroxy-5-((E)-4-hydroxystyryl)phenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: HSTZMXCBWJGKHG-CUYWLFDKSA-N
SMILES: O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1OC2=CC(/C=C/C3=CC=C(O)C=C3)=CC(O)=C2
Biological Activity: (E/Z)-Polydatin ((E/Z)-Piceid) is a mixture of the E/Z configurations of Polydatin (HY-N0120A). Polydatin can be isolated from Polygonum cuspidatum, grapes, peanuts, red wine, hop pellets, cocoa-containing products and chocolate products. Polydatin exhibits multiple biological properties, such as anti-platelet aggregation, anti-low-density lipoprotein oxidation, cardioprotective activity, anti-inflammatory and immunomodulatory functions. Polydatin shows favorable cytotoxic effects against various tumor cell lines, including cervical cancer cells, liver cancer cells, and nasopharyngeal carcinoma cells[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(E/Z)-Polydatin | 98.06% | (E/Z)-Polydatin ((E/Z)-Piceid) is a mixture of the E/Z configurations of Polydatin (HY-N0120A). Polydatin can be isolated from Polygonum cuspidatum, grapes, peanuts, red wine, hop pellets, cocoa-containing products and chocolate products. Polydatin exhibits multiple biological properties, such as anti-platelet aggregation, anti-low-density lipoprotein oxidation, cardioprotective activity, anti-inflammatory and immunomodulatory functions. Polydatin shows favorable cytotoxic effects against various tumor cell lines, including cervical cancer cells, liver cancer cells, and nasopharyngeal carcinoma cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords