60696-62-0
Chemical Structure
Norcholic acid
- CAS No.: 60696-62-0
- Formula:C23H38O5
- Molecular Weight:394.54
IUPAC Name: (R)-3-((3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid
InChIKey: SHUYNJFEXPRUGR-RTCCEZQESA-N
SMILES: C[C@@]12[C@]3([H])[C@]([C@@H](C[C@]1([H])C[C@@H](CC2)O)O)([H])[C@@]4([H])[C@]([C@H](C3)O)([C@@](CC4)([H])[C@H](C)CC(O)=O)C
Biological Activity: Norcholic acid is a normal minorbile C23 bile acid having four side chain and exsits in human urine and meconium. Norcholic acid can become prominent under certain pathological conditions. Norcholic acid is efficiently absorbed from intestine and quickly excreted into the bile but not into urine[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Norcholic acid | 99.86% | Norcholic acid is a normal minorbile C23 bile acid having four side chain and exsits in human urine and meconium. Norcholic acid can become prominent under certain pathological conditions. Norcholic acid is efficiently absorbed from intestine and quickly excreted into the bile but not into urine. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Norcholic acid (Standard) | ≥98% | Ethambutol (dihydrochloride) (Standard) is the analytical standard of Ethambutol (dihydrochloride). This product is intended for research and analytical applications. 0 | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||