177213-61-5
Chemical Structure
N4,N9-di-Boc-spermine
- No. CAS: 177213-61-5
- Formula:C20H42N4O4
- Molecular Weight:402.57
IUPAC Name: di-tert-butyl butane-1,4-diylbis((3-aminopropyl)carbamate)
InChIKey: SXSUKFQJCFUOTC-UHFFFAOYSA-N
SMILES: O=C(N(CCCCN(CCCN)C(OC(C)(C)C)=O)CCCN)OC(C)(C)C
Biological Activity: N4, N9-di-Boc-spermine is a spermine linker containing two a Boc-protected amino groups and two amine groups. The Boc groups can be deprotected under mild acidic conditions to form the free amine. The amino groups are reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. Spermidine is a polyamine that modulates various cellular activities like cellular development and differentiation, stability of DNA, and apoptosis.
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N4,N9-di-Boc-spermine | 99.85% | N4, N9-di-Boc-spermine is a spermine linker containing two a Boc-protected amino groups and two amine groups. The Boc groups can be deprotected under mild acidic conditions to form the free amine. The amino groups are reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. Spermidine is a polyamine that modulates various cellular activities like cellular development and differentiation, stability of DNA, and apoptosis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords