52-21-1
Chemical Structure
Prednisolone acetate
Synonym(s): Prednisolone 21-acetate
- CAS No.: 52-21-1
- Formula:C23H30O6
- Molecular Weight:402.48
IUPAC Name: 2-((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl acetate
InChIKey: LRJOMUJRLNCICJ-JZYPGELDSA-N
SMILES: C[C@@]12[C@](C(COC(C)=O)=O)(O)CC[C@@]1([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@@]3([H])[C@@H](O)C2)=O
Biological Activity: Prednisolone acetate (Prednisolone 21-acetate) is an adrenocortical hormone active molecule with various pharmacological effects such as anti-inflammatory, anti-allergic, and immune suppression.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Prednisolone acetate | 99.30% | Prednisolone acetate (Prednisolone 21-acetate) is an adrenocortical hormone active molecule with various pharmacological effects such as anti-inflammatory, anti-allergic, and immune suppression. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Prednisolone acetate (Standard) | 99.45% | Prednisolone acetate (Standard) is the analytical standard of Prednisolone acetate. This product is intended for research and analytical applications. Prednisolone acetate (Prednisolone 21-acetate) is an adrenocortical hormone active molecule with various pharmacological effects such as anti-inflammatory, anti-allergic, and immune suppression. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Prednisolone acetate-d8 | Prednisolone acetate-d8 is the deuterium labeled Prednisolone acetate. Prednisolone acetate (Prednisolone 21-acetate) is an adrenal cortico hormones, with anti-inflammatory, anti-allergic and immune suppressive effects. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||