100665-41-6
Chemical Structure
Ganoderenic acid B
- CAS No.: 100665-41-6
- Formula:C30H42O7
- Molecular Weight:514.65
IUPAC Name: (E)-6-((3S,7S,10S,13R,14R,17S)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid
InChIKey: QECQJYAIIIIKJB-BVKBSTOZSA-N
SMILES: CC1(C)[C@@H](O)CC[C@]2(C)C3=C([C@@]4(C(C[C@H]([C@]4(CC3=O)C)/C(C)=C/C(CC(C)C(O)=O)=O)=O)C)[C@@H](O)CC12
Biological Activity: Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ganoderenic acid B | 99.95% | Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ganoderenic acid B (Standard) | ≥98% | Doxylamine (succinate) (Standard) is the analytical standard of Doxylamine (succinate). This product is intended for research and analytical applications. Doxylamine (succinate), a first generation antihistamine, is a histamine (H1) receptor antagonist. Doxylamine is also a local analgesic agent and effective hypnotic agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||