2345732-83-2
Chemical Structure
Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal
- CAS. Nr.: 2345732-83-2
- Formula:C46H50N3O15P
- Molecular Weight:915.87
InChIKey: BACFCSKNRKGXJF-YFTVFXHHSA-N
SMILES: O=P(O)(O)OCC([C@]12[C@@]3([C@@]([C@@]4([H])[C@]([C@@]5(C(CC4)=CC(C=C5)=O)C)([H])[C@H](C3)O)([H])C[C@@]1([H])O[C@@H](C6=CC=C(C=C6)CC7=CC(NC([C@H](CCC(O)=O)NC(CN8C(C=CC8=O)=O)=O)=O)=CC=C7)O2)C)=O
Biological Activity: Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal, a glucocorticoid receptor agonist, is a drug-linker conjugate for ADC. Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal can be used to synthesize the anti-CD40 antibody agent conjugates (WO2019106608A1; example 9)[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal | Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal, a glucocorticoid receptor agonist, is a drug-linker conjugate for ADC. Glucocorticoid receptor agonist-1 phosphate Gly-Glu-Mal can be used to synthesize the anti-CD40 antibody agent conjugates (WO2019106608A1; example 9). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||