62669-70-9
Chemical Structure
Rhodamine 123
Synonym(s): RH-123; R-22420
- CAS. Nr.: 62669-70-9
- Formula:C21H17ClN2O3
- Molecular Weight:380.82
IUPAC Name: 3,6-diamino-9-(2-(methoxycarbonyl)phenyl)xanthylium chloride
InChIKey: TUFFYSFVSYUHPA-UHFFFAOYSA-M
SMILES: O=C(C1=CC=CC=C1C2=C3C=CC(N)=CC3=[O+]C4=C2C=CC(N)=C4)OC.[Cl-]
Biological Activity: Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine 123 | 99.47% | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine 123 (solution) | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. Solvent and concentration: DMSO: 5 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||