67739-71-3
Chemical Structure
3-Hydroxyflunitrazepam
Synonym(s): 3-OH FNTZ
- CAS. Nr.: 67739-71-3
- Formula:C16H12FN3O4
- Molecular Weight:329.28
IUPAC Name: 5-(2-fluorophenyl)-3-hydroxy-1-methyl-7-nitro-1,3-dihydro-2H-benzo[e][1,4]diazepin-2-one
InChIKey: KJTUBZKMFRILQD-UHFFFAOYSA-N
SMILES: O=C1C(O)N=C(C2=CC=CC=C2F)C3=CC([N+]([O-])=O)=CC=C3N1C
Biological Activity: 3-Hydroxyflunitrazepam (3-OH FNTZ) is the major metabolite of Flunitrazepam (FNTZ), generated via 3-hydroxylation by CYP3A4 (Km = 286 μM), and represents the dominant metabolic pathway (>80%) in liver microsomes. Its formation is significantly inhibited by CYP3A4 inhibitors such as Ketoconazole (HY-B0105) (IC50 = 0.11 μM) and Ritonavir (HY-90001) (IC50 = 0.041 μM), indicating a strong dependence on CYP3A4 activity and potential drug interactions[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Hydroxyflunitrazepam | 3-Hydroxyflunitrazepam (3-OH FNTZ) is the major metabolite of Flunitrazepam (FNTZ), generated via 3-hydroxylation by CYP3A4 (Km = 286 μM), and represents the dominant metabolic pathway (>80%) in liver microsomes. Its formation is significantly inhibited by CYP3A4 inhibitors such as Ketoconazole (HY-B0105) (IC50 = 0.11 μM) and Ritonavir (HY-90001) (IC50 = 0.041 μM), indicating a strong dependence on CYP3A4 activity and potential drug interactions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords