130048-57-6
Chemical Structure
Stearic acid-d4
- CAS No.: 130048-57-6
- Formula:C18H32D4O2
- Molecular Weight:288.50
IUPAC Name: octadecanoic-9,9,10,10-d4 acid
InChIKey: QIQXTHQIDYTFRH-YQUBHJMPSA-N
SMILES: CCCCCCCCC([2H])([2H])C([2H])([2H])CCCCCCCC(O)=O
Biological Activity: Stearic acid-d4 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Stearic acid-d4 | 99.8% | Stearic acid-d4 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid (Standard) | 99.87% | Stearic acid (Standard) is the analytical standard of Stearic acid. This product is intended for research and analytical applications. Stearic acid is a long-chain dietary saturated fatty acid that can significantly reduce visceral fat by inducing apoptosis of preadipocytes. Stearic acid can be used in the study of cardiovascular and metabolic diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-13C18 | 99.2% | Stearic acid-13C18is the 13C-labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-9,10-d2 | Stearic acid-9,10-d2 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d7 | 98.0% | Stearic acid-d7 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-1-13C | 99.87% | Stearic acid-1-13C is the 13C labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d5 | 98.90% | Stearic acid-d55 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d | Stearic acid-d is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d2 | 99.12% | Stearic acid-d2 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d35 | 99.89% | Stearic Acid-d35 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid-d3 | 99.90% | Stearic acid-d3 is the deuterium labeled Stearic acid. Stearic acid is a long chain dietary saturated fatty acid which exists in many animal and vegetable fats and oils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Stearic acid | 99.87% | Stearic acid is an orally active long-chain dietary saturated fatty acid that can significantly reduce visceral fat by inducing apoptosis of preadipocytes. Stearic acid can be used in the study of cardiovascular and metabolic diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||