1609105-89-6
Chemical Structure
Thailanstatin D
- CAS No.: 1609105-89-6
- Formula:C28H41NO8
- Molecular Weight:519.63
IUPAC Name: 2-((3S,5S,7S)-7-((1E,3E)-5-((2S,3S,5R,6R)-5-((S,Z)-4-acetoxypent-2-enamido)-3,6-dimethyltetrahydro-2H-pyran-2-yl)-3-methylpenta-1,3-dien-1-yl)-1,6-dioxaspiro[2.5]octan-5-yl)acetic acid
InChIKey: QPCQVHMOLDTVHX-LYSKETOYSA-N
SMILES: C[C@@H](C[C@H]([C@H](O1)C)NC(/C=C\[C@H](C)OC(C)=O)=O)[C@@H]1C/C=C(C)/C=C/[C@@H]2C[C@@]3(C[C@H](O2)CC(O)=O)CO3
Biological Activity: Thailanstatin D, an analogue of Thailanstatin A, is able to inhibit AR-V7 gene splicing by interfering the interaction between U2AF65 and SAP155 and preventing them from binding to polypyrimidine tract located between the branch point and the 3' splice site. Thailanstatin D exhibits a potent tumor inhibitory effect on human CRPC xenografts leading to cell apoptosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thailanstatin D | Thailanstatin D, an analogue of Thailanstatin A, is able to inhibit AR-V7 gene splicing by interfering the interaction between U2AF65 and SAP155 and preventing them from binding to polypyrimidine tract located between the branch point and the 3' splice site. Thailanstatin D exhibits a potent tumor inhibitory effect on human CRPC xenografts leading to cell apoptosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
