1198-77-2
Chemical Structure
Uric acid sodium
Synonym(s): Monosodium urate
- CAS. Nr.: 1198-77-2
- Formula:C5H3N4NaO3
- Molecular Weight:190.09
IUPAC Name: sodium 2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-8-olate
InChIKey: NAFSTSRULRIERK-UHFFFAOYSA-M
SMILES: O=C(N1)NC2=C(N=C(O[Na])N2)C1=O
Biological Activity: Uric acid sodium (Monosodium urate), scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid sodium can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uric acid sodium | 99.53% | Uric acid sodium (Monosodium urate), scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid sodium can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid sodium (Standard) | 99.88% | Uric acid (sodium) (Standard) is the analytical standard of Uric acid (sodium). This product is intended for research and analytical applications. Uric acid sodium (Monosodium urate), scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid sodium can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Yasutake Y, et al. Uric acid ameliorates indomethacin-induced enteropathy in mice through its antioxidant activity. J Gastroenterol Hepatol. 2017;32(11):1839-1845. [Content Brief]
- [2]. Wang Q, et al. Recent Progress on Uric Acid Detection: A Review. Crit Rev Anal Chem. 2020;50(4):359-375. [Content Brief]