34346-01-5
Chemical Structure
PLGA (50:50)
Synonym(s): poly(lactic-co-glycolic acid) (50:50)
- CAS. Nr.: 34346-01-5
- Formula:(C3H6O3)n.(C2H4O3)n
- Molecular Weight:10000-20000
SMILES: O=C(O)C(C)OC(CO[H])=O.[x].[y]
Biological Activity: PLGA (50:50) (poly(lactic-co-glycolic acid) (50:50)) is a copolymer of poly lactic acid (PLA) and poly glycolic acid (PGA) which can be used to fabricate devices for drug delivery and tissue engineering applications.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PLGA (50:50) | 99.41% | PLGA (50:50) (poly(lactic-co-glycolic acid) (50:50)) is a copolymer of poly lactic acid (PLA) and poly glycolic acid (PGA) which can be used to fabricate devices for drug delivery and tissue engineering applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
PLGA (75:25) | 99.54% | PLGA (75:25) is a low toxicity, biocompatible and biodegradable controlled drug delivery carrier, can achieve slow release in the organism. PLGA (75:25) is a copolymer of 75% poly lactic acid (PLA) and 25% poly glycolic acid (PGA). PLGA (75:25) has been extensively studied as delivery vehicles for agents, proteins and various other macromolecules such as DNA, RNA and peptides. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords