39156-67-7
Chemical Structure
Dihydrocytochalasin B
- CAS. Nr.: 39156-67-7
- Formula:C29H39NO5
- Molecular Weight:481.62
IUPAC Name: (3S,3aS,4S,6S,6aS,10R,14R,18aS,E)-3-benzyl-6,14-dihydroxy-4,10-dimethyl-5-methylene-3,3a,4,5,6,6a,9,10,11,12,13,14,15,16-tetradecahydro-1H-[1]oxacyclotetradecino[2,3-d]isoindole-1,17(2H)-dione
InChIKey: WIULKAASLBZREV-RXPQEOCGSA-N
SMILES: O=C1[C@]2(O3)[C@]([C@@H](C([C@@H](O)[C@]2([H])/C=C/C[C@@H](CCC[C@@H](O)CCC3=O)C)=C)C)([H])[C@H](CC4=CC=CC=C4)N1
Biological Activity: Dihydrocytochalasin B is an Actin disruptor. Dihydrocytochalasin B disrupts actin microfilament bundles, inhibits actin polymerization, and alters intracellular actin cytoskeletal structures. Dihydrocytochalasin B blocks the initiation of DNA synthesis. Dihydrocytochalasin B inhibits Calcium transport. Dihydrocytochalasin B inhibits cytokinesis and alters cell morphology. Dihydrocytochalasin B can be used in studies related to rickets[1][2][3].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dihydrocytochalasin B | 99.0% | Dihydrocytochalasin B is an Actin disruptor. Dihydrocytochalasin B disrupts actin microfilament bundles, inhibits actin polymerization, and alters intracellular actin cytoskeletal structures. Dihydrocytochalasin B blocks the initiation of DNA synthesis. Dihydrocytochalasin B inhibits Calcium transport. Dihydrocytochalasin B inhibits cytokinesis and alters cell morphology. Dihydrocytochalasin B can be used in studies related to rickets. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Maness PF, et al. Dihydrocytochalasin B disorganizes actin cytoarchitecture and inhibits initiation of DNA synthesis in 3T3 cells. Cell. 1982 Aug;30(1):253-62. [Content Brief]
- [2]. Jande SS, et al. Effects of cytochalasin B and dihydrocytochalasin B on calcium transport by intestinal absorptive cells. Calcif Tissue Int. 1981;33(2):143-151. [Content Brief]
- [3]. Atlas SJ, et al. Dihydrocytochalasin B. Biological effects and binding to 3T3 cells. J Cell Biol. 1978 Feb;76(2):360-70. [Content Brief]
Keywords