482-54-2
Chemical Structure
1,2-Cyclohexylenedinitrilotetraacetic acid
Synonym(s): CDTA
- CAS. Nr.: 482-54-2
- Formula:C14H22N2O8
- Molecular Weight:346.33
IUPAC Name: 2,2',2'',2'''-(cyclohexane-1,2-diylbis(azanetriyl))tetraacetic acid
InChIKey: FCKYPQBAHLOOJQ-UHFFFAOYSA-N
SMILES: C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
Biological Activity: 1,2-Cyclohexylenedinitrilotetraacetic acid (CDTA) is a chelating agent. 1,2-Cyclohexylenedinitrilotetraacetic acid has an ability to remove manganese from brain and liver (in vivo) and their sub-cellular fractions (in vitro), of rats pretreated with manganese sulphate[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1,2-Cyclohexylenedinitrilotetraacetic acid | 99.91% | 1,2-Cyclohexylenedinitrilotetraacetic acid (CDTA) is a chelating agent. 1,2-Cyclohexylenedinitrilotetraacetic acid has an ability to remove manganese from brain and liver (in vivo) and their sub-cellular fractions (in vitro), of rats pretreated with manganese sulphate. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,2-Cyclohexylenedinitrilotetraacetic acid (Standard) | ≥98% | 1,2-Cyclohexylenedinitrilotetraacetic acid (Standard) is the analytical standard of 1,2-Cyclohexylenedinitrilotetraacetic acid (HY-W102714). This product is intended for research and analytical applications. 1,2-Cyclohexylenedinitrilotetraacetic acid (CDTA) is a chelating agent. 1,2-Cyclohexylenedinitrilotetraacetic acid has an ability to remove manganese from brain and liver (in vivo) and their sub-cellular fractions (in vitro), of rats pretreated with manganese sulphate. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||