917-13-5
Chemical Structure
Enniatin B
- CAS. Nr.: 917-13-5
- Formula:C33H57N3O9
- Molecular Weight:639.82
IUPAC Name: (3S,6R,9S,12R,15S,18R)-3,6,9,12,15,18-hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexaone
InChIKey: MIZMDSVSLSIMSC-VYLWARHZSA-N
SMILES: CC([C@](O1)([H])C(N([C@H](C(O[C@@H](C(N([C@](C(C)C)([H])C(O[C@H](C(C)C)C(N(C)[C@@H](C(C)C)C1=O)=O)=O)C)=O)C(C)C)=O)C(C)C)C)=O)C
Biological Activity: Enniatin B is a Fusarium mycotoxin. Enniatin B inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 113 μM in an enzyme assay using rat liver microsomes[1]. Enniatins B decreases the activation of ERK (p44/p42)[2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Enniatin B | 99.86% | Enniatin B is a Fusarium mycotoxin. Enniatin B inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 113 μM in an enzyme assay using rat liver microsomes. Enniatins B decreases the activation of ERK (p44/p42). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Enniatin B-13C33 | Enniatin B-13C33 is the 13C-labeled Enniatin B (HY-N3806). Enniatin B is a Fusarium mycotoxin. Enniatin B inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 113 μM in an enzyme assay using rat liver microsomes. Enniatins B decreases the activation of ERK (p44/p42). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Tomoda H, et al. Inhibition of acyl-CoA: cholesterol acyltransferase activity by cyclodepsipeptide antibiotics. J Antibiot (Tokyo). 1992 Oct;45(10):1626-32. [Content Brief]
- [2]. Wätjen W, et al. Enniatins A1, B and B1 from an endophytic strain of Fusarium tricinctum induce apoptotic cell death in H4IIE hepatoma cells accompanied by inhibition of ERK phosphorylation. Mol Nutr Food Res. 2009 Apr;53(4):431-40. [Content Brief]
Keywords