500883-59-0
Chemical Structure
DDAO phosphate diammonium
- No. CAS: 500883-59-0
- Formula:C15H18Cl2N3O5P
- Molecular Weight:422.20
IUPAC Name: 6,8-dichloro-9,9-dimethyl-7-oxo-7,9-dihydroacridin-2-yl dihydrogen phosphate, diammonia salt
InChIKey: BJSNVTPPOAOWCF-UHFFFAOYSA-N
SMILES: O=C1C(Cl)=CC2=NC3=C(C(C)(C)C2=C1Cl)C=C(OP(O)(O)=O)C=C3.N.N
Biological Activity: DDAO phosphate diammonium is a fluorescent phosphatase substrate. DDAO phosphate diammonium has tunable excitation wavelength (600-650nm) and long emission wavelength (λem=656nm). DDAO phosphate diammonium can be used to detect the activity of different enzymes such as β-galactosidase, sulfatase, protein phosphatase 2A, carboxylesterase 2, human albumin and esterase.
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DDAO phosphate diammonium | DDAO phosphate diammonium is a fluorescent phosphatase substrate. DDAO phosphate diammonium has tunable excitation wavelength (600-650nm) and long emission wavelength (λem=656nm). DDAO phosphate diammonium can be used to detect the activity of different enzymes such as β-galactosidase, sulfatase, protein phosphatase 2A, carboxylesterase 2, human albumin and esterase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords