1443553-08-9
Chemical Structure
ATTO 488 carboxylic acid
- CAS No.: 1443553-08-9
- Formula:C25H23N3O10S2
- Molecular Weight:589.59
IUPAC Name: 3,6-diamino-9-(2-((3-carboxypropyl)(methyl)carbamoyl)phenyl)-5-sulfoxanthylium-4-sulfonate
InChIKey: PNCUNWSKHFBORG-UHFFFAOYSA-N
SMILES: O=C(CCCN(C)C(C1=C(C2=C(C=CC(N)=C3S(=O)(O)=O)C3=[O+]C4=C2C=CC(N)=C4S(=O)([O-])=O)C=CC=C1)=O)O
Biological Activity: ATTO 488 carboxylic acid is a new fluorescent label based on the Rhodamine structure. It has strong absorption, high fluorescence quantum yield, high thermal stability and photochemical stability, and is suitable for single molecule detection and high-resolution microscopy. ATTO 488 carboxylic acid is a carboxylic acid derivative of ATTO 488, which can be used to label proteins or antibodies.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ATTO 488 carboxylic acid | 97.24% | ATTO 488 carboxylic acid is a new fluorescent label based on the Rhodamine structure. It has strong absorption, high fluorescence quantum yield, high thermal stability and photochemical stability, and is suitable for single molecule detection and high-resolution microscopy. ATTO 488 carboxylic acid is a carboxylic acid derivative of ATTO 488, which can be used to label proteins or antibodies. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords