601519-75-9
Chemical Structure
BMS-358233
- CAS No.: 601519-75-9
- Formula:C25H25ClN6O2S
- Molecular Weight:509.02
IUPAC Name: (R)-N-(2-chloro-6-methylphenyl)-2-((6-methyl-2-(((tetrahydrofuran-2-yl)methyl)amino)pyrimidin-4-yl)amino)benzo[d]thiazole-6-carboxamide
InChIKey: QONHZAOUSLDLOE-QGZVFWFLSA-N
SMILES: O=C(C1=CC=C2N=C(NC3=NC(NC[C@@H]4OCCC4)=NC(C)=C3)SC2=C1)NC5=C(C)C=CC=C5Cl
Biological Activity: PU3 is a small molecule inhibitor of Hsp90 that competes with geldanamycin for Hsp90. PU3 induces degradation of proteins, including Her2, similar to geldanamycin. PU3 inhibits the growth of breast cancer cells, causing retinoblastoma protein hypophosphorylation, G1 arrest, and differentiation. PU3 represents a novel class of synthetic compounds that bind to Hsp90 and inhibit the proliferation of cancer cells. PU3 could provide a new strategy for the treatment of cancers[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BMS-358233 | PU3 is a small molecule inhibitor of Hsp90 that competes with geldanamycin for Hsp90. PU3 induces degradation of proteins, including Her2, similar to geldanamycin. PU3 inhibits the growth of breast cancer cells, causing retinoblastoma protein hypophosphorylation, G1 arrest, and differentiation. PU3 represents a novel class of synthetic compounds that bind to Hsp90 and inhibit the proliferation of cancer cells. PU3 could provide a new strategy for the treatment of cancers. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords