53730-90-8
53730-90-8
Chemical Structure
Dehydrobruceine B
- CAS No.: 53730-90-8
- Formula:C23H26O11
- Molecular Weight:478.45
IUPAC Name: methyl 2,5,6-trichloronicotinate
InChIKey: JXTROYJRNXSSKW-XUVISEOFSA-N
SMILES: COC([C@]12[C@@]3([H])[C@@]4(CO2)[C@@]([C@H]([C@@H]1O)O)([H])[C@@]5(C(C[C@@]4([H])OC([C@@H]3OC(C)=O)=O)=C(C(C(O)=C5)=O)C)C)=O
Biological Activity: Dehydrobruceine B, a quassinoid, can be isolated from Brucea javanica. Dehydrobruceine B shows a synergistic effect with Cisplatin (HY-17394) to induce apoptosis via mitochondrial method. Dehydrobruceine B increases apoptosis-inducing factor (AIF) and Bax expression and suppresses Keap1-Nrf2[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dehydrobruceine B | Dehydrobruceine B, a quassinoid, can be isolated from Brucea javanica. Dehydrobruceine B shows a synergistic effect with Cisplatin (HY-17394) to induce apoptosis via mitochondrial method. Dehydrobruceine B increases apoptosis-inducing factor (AIF) and Bax expression and suppresses Keap1-Nrf2. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
