15720-01-1
Chemical Structure
iso-ADP ribose
- CAS. Nr.: 15720-01-1
- Formula:C15H23N5O14P2
- Molecular Weight:559.32
IUPAC Name: ((2R,3R,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-(((2S,3R,4S,5R)-3,4-dihydroxy-5-((phosphonooxy)methyl)tetrahydrofuran-2-yl)oxy)-3-hydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate
InChIKey: BHIWBSNWEZIHHL-ZQSHOCFMSA-N
SMILES: NC1=NC=NC2=C1N=CN2[C@H]3[C@H](O[C@H]4[C@H](O)[C@H](O)[C@@H](COP(O)(O)=O)O4)[C@H](O)[C@@H](COP(O)(O)=O)O3
Biological Activity: iso-ADP ribose is the small-molecule ligand for protein nucleic acid modification, comprising parts of two consecutive ADP-ribosyl units within the PAR chain. iso-ADP ribose specifically binds WWE, FHA and OB-fold domains, enabling PAR-dependent functional responses like ubiquitylation and supporting DNA damage signaling and repair. iso-ADP ribose can be used for cancer research[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
iso-ADP ribose | iso-ADP ribose is the small-molecule ligand for protein nucleic acid modification, comprising parts of two consecutive ADP-ribosyl units within the PAR chain. iso-ADP ribose specifically binds WWE, FHA and OB-fold domains, enabling PAR-dependent functional responses like ubiquitylation and supporting DNA damage signaling and repair. iso-ADP ribose can be used for cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords