2705841-52-5
Chemical Structure
8RK64
- CAS. Nr.: 2705841-52-5
- Formula:C14H16N8O2S
- Molecular Weight:360.39
IUPAC Name: (S)-N-(5-(2-azidoacetyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-1-cyanopyrrolidine-3-carboxamide
InChIKey: KIWKRCCIHSGWQS-VIFPVBQESA-N
SMILES: N#CN1CC[C@@H](C1)C(NC2=NC3=C(S2)CN(CC3)C(CN=[N+]=[N-])=O)=O
Biological Activity: 8RK64, a chemical probe, is a covalent UCHL1 inhibitor (IC50: 0.32 μM)[1]. 8RK64 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8RK64 | 99.50% | 8RK64, a chemical probe, is a covalent UCHL1 inhibitor (IC50: 0.32 μM). 8RK64 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords