554-95-0
Chemical Structure
Benzene-1,3,5-tricarboxylic acid
Synonym(s): Trimesic acid
- CAS. Nr.: 554-95-0
- Formula:C9H6O6
- Molecular Weight:210.14
IUPAC Name: benzene-1,3,5-tricarboxylic acid
InChIKey: QMKYBPDZANOJGF-UHFFFAOYSA-N
SMILES: O=C(C1=CC(C(O)=O)=CC(C(O)=O)=C1)O
Biological Activity: Benzene-1,3,5-tricarboxylic acid (Trimesic acid) is a rigid planar small-molecule scaffold and crosslinker. Benzene-1,3,5-tricarboxylic acid induces bicyclic peptides to adopt a planar conformation, so as to maximize surface area and bind to the flat protein surfaces involved in protein-protein interactions. Benzene-1,3,5-tricarboxylic acid forms ionic crosslinks, hydrogen bonds and π-π bonds with chitosan, thereby constructing a hydrogel network. Benzene-1,3,5-tricarboxylic acid endows chitosan hydrogel systems with specific mechanical properties, enabling sustained release of cancer therapeutic drugs including 5-Fluorouracil (HY-90006)[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzene-1,3,5-tricarboxylic acid | 99.75% | Benzene-1,3,5-tricarboxylic acid (Trimesic acid) is a rigid planar small-molecule scaffold and crosslinker. Benzene-1,3,5-tricarboxylic acid induces bicyclic peptides to adopt a planar conformation, so as to maximize surface area and bind to the flat protein surfaces involved in protein-protein interactions. Benzene-1,3,5-tricarboxylic acid forms ionic crosslinks, hydrogen bonds and π-π bonds with chitosan, thereby constructing a hydrogel network. Benzene-1,3,5-tricarboxylic acid endows chitosan hydrogel systems with specific mechanical properties, enabling sustained release of cancer therapeutic drugs including 5-Fluorouracil (HY-90006). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Benzene-1,3,5-tricarboxylic acid-d3 | 99.21% | Benzene-1,3,5-tricarboxylic acid-d3 (Trimesic acid-d3) is the deuterium labeled Benzene-1,3,5-tricarboxylic acid (HY-78985). Benzene-1,3,5-tricarboxylic acid (Trimesic acid) is a rigid planar small-molecule scaffold and crosslinker. Benzene-1,3,5-tricarboxylic acid induces bicyclic peptides to adopt a planar conformation, so as to maximize surface area and bind to the flat protein surfaces involved in protein-protein interactions. Benzene-1,3,5-tricarboxylic acid forms ionic crosslinks, hydrogen bonds and π-π bonds with chitosan, thereby constructing a hydrogel network. Benzene-1,3,5-tricarboxylic acid endows chitosan hydrogel systems with specific mechanical properties, enabling sustained release of cancer therapeutic drugs including 5-Fluorouracil (HY-90006). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Lian W, et al. Screening bicyclic peptide libraries for protein-protein interaction inhibitors: discovery of a tumor necrosis factor-α antagonist. J Am Chem Soc. 2013;135(32):11990-11995. [Content Brief]
- [2]. Emani S, et al. Chitosan Hydrogels Cross-Linked with Trimesic Acid for the Delivery of 5-Fluorouracil in Cancer Therapy. Pharmaceutics. 2023;15(4):1084. Published 2023 Mar 28. [Content Brief]