171486-59-2
Chemical Structure
2'-O-Propargyl A(Bz)-3'-phosphoramidite
- CAS No.: 171486-59-2
- Formula:C50H54N7O8P
- Molecular Weight:911.98
IUPAC Name: (2R,3R,4R,5R)-5-(6-benzamido-9H-purin-9-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-(prop-2-yn-1-yloxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
InChIKey: ZNKFQCJEZKZIPC-XOMUZYEBSA-N
SMILES: C#CCO[C@@H]1[C@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](COC(C2=CC=CC=C2)(C3=CC=C(OC)C=C3)C4=CC=C(OC)C=C4)O[C@H]1N5C=NC6=C5N=CN=C6NC(C7=CC=CC=C7)=O
Biological Activity: 2'-O-Propargyl A(Bz)-3'-phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. 2'-O-Propargyl A(Bz)-3'-phosphoramidite is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-O-Propargyl A(Bz)-3'-phosphoramidite | 2'-O-Propargyl A(Bz)-3'-phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). 2'-O-Propargyl A(Bz)-3'-phosphoramidite is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||