1257650-86-4
Chemical Structure
((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate-15N4 sodium
- CAS No.: 1257650-86-4
- Formula:C10H12N15N4Na2O8P
- Molecular Weight:411.16
IUPAC Name: (R)-(5-(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxydihydro-2l3,3l3,4l3-furan-2(3H)-yl-2,3,4,5-13C4)-l2-methyl-13C dihydrogen phosphate
InChIKey: PVBRXXAAPNGWGE-PBBMHHSJSA-L
SMILES: O=C1C2=C([15NH]C(N)=[15N]1)[15N]([C@]3([H])O[C@@H]([C@H]([C@H]3O)O)COP(O[Na])(O[Na])=O)C=[15N]2
Biological Activity: ((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate-15N4 (sodium) is a 15N-labeled ((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate (so
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate-15N4 sodium | ((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate-15N4 (sodium) is a 15N-labeled ((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate (so | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid (Standard) | 99.74% | 5'-Guanylic acid is a purine nucleotide that participates in physiological processes such as energy metabolism, signal transduction, and gene expression regulation. 5'-Guanylic acid regulates the expression of genes related to fatty acid metabolism. 5'-Guanylic acid is the weak agonist for ionotropic glutamate receptors (iGluR), reduces the activity of the glutamatergic system and exhibits neuroprotective effect. 5'-Guanylic acid also causes neuronal cell death at high concentrations. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid-13C10 dilithium | 5'-Guanylic acid-13C10 (5'-GMP-13C10 dilithium; 5'-guanosine monophosphate-13C10) dilithium is 13C-labeled 5'-Guanylic acid (HY-N5134). 5'-Guanylic acid (5'-GMP) is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid-d12 dilithium | 5'-Guanylic acid-d12 (5'-GMP-d12 dilithium; 5'-guanosine monophosphate-d12) dilithium is deuterium labeled 5'-Guanylic acid (HY-N5134). 5'-Guanylic acid (5'-GMP) is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid-15N5,d12 dilithium | 5'-Guanylic acid-15N5,d12 (5'-GMP-15N5,d12 dilithium; 5'-guanosine monophosphate-15N5,d12) dilithium is deuterium and 15N labeled 5'-Guanylic acid (HY-N5134). 5'-Guanylic acid (5'-GMP) is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid-13C10,15N5 dilithium | 5'-Guanylic acid-13C10,15N5 (5'-GMP-13C10,15N5 dilithium; 5'-guanosine monophosphate-13C10,15N5) dilithium is 13C and 15N-labeled 5'-Guanylic acid (HY-N5134). 5'-Guanylic acid (5'-GMP) is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid-15N5 dilithium | 99.33% | 5'-Guanylic acid-15N5 (5'-GMP-15N5 dilithium; 5'-guanosine monophosphate-15N5) dilithium is 15N labeled 5'-Guanylic acid (HY-N5134). 5'-Guanylic acid (5'-GMP) is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5'-Guanylic acid | 99.96% | 5'-Guanylic acid is a purine nucleotide that participates in physiological processes such as energy metabolism, signal transduction, and gene expression regulation. 5'-Guanylic acid regulates the expression of genes related to fatty acid metabolism. 5'-Guanylic acid is the weak agonist for ionotropic glutamate receptors (iGluR), reduces the activity of the glutamatergic system and exhibits neuroprotective effect. 5'-Guanylic acid also causes neuronal cell death at high concentrations. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
- ((2R,3S,4R,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl phosphate-15N4 sodium
- 5'-Guanylic acid (Standard)
- 5'-Guanylic acid-13C10 dilithium
- 5'-Guanylic acid-d12 dilithium
- 5'-Guanylic acid-15N5,d12 dilithium
- 5'-Guanylic acid-13C10,15N5 dilithium
- 5'-Guanylic acid-15N5 dilithium
- 5'-Guanylic acid