RPS6 - ribosomal protein S6 Gene
Also Known as S6
Species: Homo sapiens
About RPS6
This gene has 5 transcripts (splice variants) and 184 orthologues. Ubiquitous expression in ovary (RPKM 2180.7), bone marrow (RPKM 1555.2) and 25 other tissues.
Summary
Ribosomes, the organelles that catalyze protein synthesis, consist of a small 40S subunit and a large 60S subunit. Together these subunits are composed of 4 RNA species and approximately 80 structurally distinct proteins. This gene encodes a cytoplasmic ribosomal protein that is a component of the 40S subunit. The protein belongs to the S6E family of ribosomal proteins. It is the major substrate of protein kinases in the ribosome, with subsets of five C-terminal serine residues phosphorylated by different protein kinases. Phosphorylation is induced by a wide range of stimuli, including growth factors, tumor-promoting agents, and mitogens. Dephosphorylation occurs at growth arrest. The protein may contribute to the control of cell growth and proliferation through the selective translation of particular classes of mRNA. As is typical for genes encoding ribosomal proteins, there are multiple processed pseudogenes of this gene dispersed through the genome. [provided by RefSeq, Jul 2008]
RPS6 Products (1)
| mRNA | Protein | Name |
|---|---|---|
| NM_001010.3 | NP_001001.2 | 40S ribosomal protein S6 |
| Molecular Function GO Annotation | Evidence | Références | Source |
|---|---|---|---|
| enables protein binding |
IPI
IPI: Inferred from physical interaction
|
16314389 | GOA |
| enables protein kinase binding |
IPI
IPI: Inferred from physical interaction
|
21418524 | GOA |
| enables structural constituent of ribosome |
IDA
IDA: Inferred from direct assay
|
8706699 | GOA |
| enables structural constituent of ribosome |
IMP
IMP: Inferred from mutant phenotype
|
18697920 | GOA |
| Biological Process GO Annotation | Evidence | Références | Source |
|---|---|---|---|
| involved in TOR signaling |
IDA
IDA: Inferred from direct assay
|
16428328 | GOA |
| involved in cytoplasmic translation |
IDA
IDA: Inferred from direct assay
|
8706699 | GOA |
| involved in positive regulation of apoptotic process |
IDA
IDA: Inferred from direct assay
|
18362888 | GOA |
| involved in positive regulation of cell population proliferation |
IMP
IMP: Inferred from mutant phenotype
|
17220279 | GOA |
| involved in rRNA processing |
IMP
IMP: Inferred from mutant phenotype
|
18697920 | GOA |
| involved in ribosomal small subunit biogenesis |
IDA
IDA: Inferred from direct assay
|
34516797 | GOA |
| involved in ribosomal small subunit biogenesis |
IMP
IMP: Inferred from mutant phenotype
|
18697920 | GOA |
| Cellular Component GO Annotation | Evidence | Références | Source |
|---|---|---|---|
| located in cell body |
IDA
IDA: Inferred from direct assay
|
15121898 | GOA |
| located in cytoplasmic ribonucleoprotein granule |
IDA
IDA: Inferred from direct assay
|
15121898 | GOA |
| is active in cytosolic ribosome |
IDA
IDA: Inferred from direct assay
|
8706699 | GOA |
| located in cytosolic ribosome |
IDA
IDA: Inferred from direct assay
|
23636399 | GOA |
| part of cytosolic small ribosomal subunit |
IDA
IDA: Inferred from direct assay
|
8706699 | GOA |
| located in dendrite |
IDA
IDA: Inferred from direct assay
|
15121898 | GOA |
| located in nucleolus |
IDA
IDA: Inferred from direct assay
|
8590812 | GOA |
| located in nucleus |
IDA
IDA: Inferred from direct assay
|
2334893 | GOA |
| part of ribonucleoprotein complex |
IDA
IDA: Inferred from direct assay
|
18809582 | GOA |
| part of small ribosomal subunit |
IDA
IDA: Inferred from direct assay
|
15590835 | GOA |
| part of small-subunit processome |
IDA
IDA: Inferred from direct assay
|
34516797 | GOA |
RPS6 Protein Structure
Ribosomal_S6e: Ribosomal protein S6e (1 - 127)
- 0
- 100
- 200
- 249 a.a.
| Protein Preferred Names | Protein Names | |
|---|---|---|
|
40S ribosomal protein S6 |
|
RPS6 Protein-protein interaction Information
|
Type
|
Protein Name | Protein ID | Interactor | Interactor Species | Interactor ID | Detection Method | Références |
|---|---|---|---|---|---|---|---|
|
Intra
|
RPS6 | P62753 | PASK | Homo sapiens | Q96RG2 | 21418524 | |
|
Intra
|
RPS6 | P62753 | PASK | Homo sapiens | Q96RG2 | 21418524 | |
|
Cross
|
RPS6 | P62753 | N | SARS-CoV-2 | P0DTC9 | 36217030 | |
|
Intra
|
RPS6 | P62753 | NCBP1 | Homo sapiens | Q09161 | 18423201 | |
|
Intra
|
RPS6 | P62753 | NCBP1 | Homo sapiens | Q09161 | 18423201 | |
|
Intra
|
RPS6 | P62753 | NPM1 | Homo sapiens | P06748 | 30021884 | |
|
Intra
|
RPS6 | P62753 | NPM1 | Homo sapiens | P06748 | 29568061 |
RPS6 Anticorps
| Cat. No. | Nom du produit | Application | Reactivity |
|---|---|---|---|
| HY-P80885 | RPS6 Antibody (YA677) | WB, ICC/IF, IP | Human, Mouse, Rat, Monkey |
| HY-P80885A | RPS6 Antibody (YA677)(PBS only) | WB, ICC/IF, IP | Human, Mouse, Rat, Monkey |
| HY-P83767 | Phospho-RPS6 (Ser235/Ser236) Antibody (YA3570) | WB, IHC-P, ICC/IF | Human, Mouse, Rat |
| HY-P83767A | Phospho-RPS6 (Ser235/Ser236) Antibody (YA3570) (PBS only) | WB, IHC-P, ICC/IF | Human, Mouse, Rat |
| HY-P86147 | Phospho-RPS6(Ser240/Ser244) Antibody (YA5839) | WB, IHC-P, ICC/IF | Human, Mouse, Rat |
| HY-P86147A | Phospho-RPS6(Ser240/Ser244) Antibody (YA5839)(PBS only) | WB, IHC-P, ICC/IF | Human, Mouse |
| HY-P86216 | RPS6 Antibody (YA5908) | WB, IHC-P, ICC/IF, IP | Human, Mouse, Rat |
| HY-P86216A | RPS6 Antibody (YA5908)(PBS only) | WB, IHC-P, ICC/IF, FC | Human, Mouse, Rat |
Related Diseases
| Diseases | Alias | |
|---|---|---|
| Tuberous Sclerosis |
|
|
| Lymphangioleiomyomatosis |
|
|
| Squamous Cell Carcinoma |
|
|
| Muscle Hypertrophy |
|
|
| Motor Neuron Disease |
|
|
| Subependymal Glioma |
|
|
| Kidney Angiomyolipoma |
|
|
| Diamond-Blackfan Anemia 6 |
|
|
| Rett Syndrome |
|
|
| Pyriform Sinus Cancer |
|
|
| Acute Promyelocytic Leukemia |
|
|
| Diamond-Blackfan Anemia |
|
|
| Prostate Cancer |
|
|
| Cowden Syndrome |
|
|
Orthologs Information
| Species | Symbol | Source | ID |
|---|---|---|---|
| Mus musculus | RPS6 | MGD | MGI:98159 |
| Felis catus | RPS6 | VGNC | VGNC:97612 |
| Rattus norvegicus | RPS6 | RGD | RGD:3602 |
| Others | RPS6 | NCBI |