1246817-13-9
Chemical Structure
Glurate-d5
Synonym(s): 4-Acetylbutyric acid-d5; 5-Oxohexanoic acid-d5; NSC-5281-d5
- CAS No.: 1246817-13-9
- Formula:C6H5D5O3
- Molecular Weight:135.17
IUPAC Name: 5-oxohexanoic-4,4,6,6,6-d5 acid
InChIKey: MGTZCLMLSSAXLD-WNWXXORZSA-N
SMILES: O=C(C([2H])([2H])[2H])C([2H])(CCC(O)=O)[2H]
Biological Activity: Glurate-d5 (4-Acetylbutyric acid-d5; 5-Oxohexanoic acid-d5; NSC-5281-d5) is the deuterium labeled Glurate (HY-W001957). Glurate (4-Acetylbutyric acid) is an acylating agent. Glurate can be used in the development of antiviral compounds, especially those targeting retroviruses such as herpes virus and HIV. Glurate can be used in the synthesis of acyclic nucleoside derivatives and 5-hydroxyhexanoic acid[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Glurate-d5 | Glurate-d5 (4-Acetylbutyric acid-d5; 5-Oxohexanoic acid-d5; NSC-5281-d5) is the deuterium labeled Glurate (HY-W001957). Glurate (4-Acetylbutyric acid) is an acylating agent. Glurate can be used in the development of antiviral compounds, especially those targeting retroviruses such as herpes virus and HIV. Glurate can be used in the synthesis of acyclic nucleoside derivatives and 5-hydroxyhexanoic acid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Glurate (Standard) | ≥98% | Glurate (Standard) is the analytical standard of Glurate (HY-W001957). This product is used for research and analytical applications. Glurate (4-Acetylbutyric acid) is an acylating agent. Glurate can be used in the development of antiviral compounds, especially those targeting retroviruses such as herpes virus and HIV. Glurate can be used in the synthesis of acyclic nucleoside derivatives and 5-hydroxyhexanoic acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Glurate | 98.54% | Glurate (4-Acetylbutyric acid) is an acylating agent. Glurate can be used in the development of antiviral compounds, especially those targeting retroviruses such as herpes virus and HIV. Glurate can be used in the synthesis of acyclic nucleoside derivatives and 5-hydroxyhexanoic acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||